C22H28Cl2N4O — CID 119531604
2-methyl-1-phenyl-N-propyl-N-pyrrolidin-3-ylbenzimidazole-5-carboxamide;dihydrochloride (PubChem CID 119531604) has the molecular formula C22H28Cl2N4O and a molecular weight of 435.40 g/mol. Its IUPAC name is 2-methyl-1-phenyl-N-propyl-N-pyrrolidin-3-ylbenzimidazole-5-carboxamide;dihydrochloride.
| Compound Name | 2-methyl-1-phenyl-N-propyl-N-pyrrolidin-3-ylbenzimidazole-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119531604 |
| Molecular Formula | C22H28Cl2N4O |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-methyl-1-phenyl-N-propyl-N-pyrrolidin-3-ylbenzimidazole-5-carboxamide;dihydrochloride |
| SMILES | CCCN(C(=O)c1ccc2c(c1)nc(C)n2-c1ccccc1)C1CCNC1.Cl.Cl |
| InChI | InChI=1S/C22H26N4O.2ClH/c1-3-13-25(19-11-12-23-15-19)22(27)17-9-10-21-20(14-17)24-16(2)26(21)18-7-5-4-6-8-18;;/h4-10,14,19,23H,3,11-13,15H2,1-2H3;2*1H |
| InChIKey | XAPPPFHNSRAVCJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |