C14H21ClN4O4S — CID 119453672
5-acetamido-2-(methanesulfonamido)-N-pyrrolidin-3-ylbenzamide;hydrochloride (PubChem CID 119453672) has the molecular formula C14H21ClN4O4S and a molecular weight of 376.87 g/mol. Its IUPAC name is 5-acetamido-2-(methanesulfonamido)-N-pyrrolidin-3-ylbenzamide;hydrochloride.
| Compound Name | 5-acetamido-2-(methanesulfonamido)-N-pyrrolidin-3-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119453672 |
| Molecular Formula | C14H21ClN4O4S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 5-acetamido-2-(methanesulfonamido)-N-pyrrolidin-3-ylbenzamide;hydrochloride |
| SMILES | CC(=O)Nc1ccc(NS(C)(=O)=O)c(C(=O)NC2CCNC2)c1.Cl |
| InChI | InChI=1S/C14H20N4O4S.ClH/c1-9(19)16-10-3-4-13(18-23(2,21)22)12(7-10)14(20)17-11-5-6-15-8-11;/h3-4,7,11,15,18H,5-6,8H2,1-2H3,(H,16,19)(H,17,20);1H |
| InChIKey | PNLBHVLTACPNPA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |