C21H26ClN3O3S — CID 119458614
N-(8-azabicyclo[3.2.1]octan-3-yl)-4-[(2-methylphenyl)sulfamoyl]benzamide;hydrochloride (PubChem CID 119458614) has the molecular formula C21H26ClN3O3S and a molecular weight of 435.98 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-4-[(2-methylphenyl)sulfamoyl]benzamide;hydrochloride.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-4-[(2-methylphenyl)sulfamoyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119458614 |
| Molecular Formula | C21H26ClN3O3S |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-4-[(2-methylphenyl)sulfamoyl]benzamide;hydrochloride |
| SMILES | Cc1ccccc1NS(=O)(=O)c1ccc(C(=O)NC2CC3CCC(C2)N3)cc1.Cl |
| InChI | InChI=1S/C21H25N3O3S.ClH/c1-14-4-2-3-5-20(14)24-28(26,27)19-10-6-15(7-11-19)21(25)23-18-12-16-8-9-17(13-18)22-16;/h2-7,10-11,16-18,22,24H,8-9,12-13H2,1H3,(H,23,25);1H |
| InChIKey | APIBTHNEXQQOEO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |