C17H21N3O — CID 119460242
2-methyl-N-(piperidin-3-ylmethyl)quinoline-8-carboxamide (PubChem CID 119460242) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-methyl-N-(piperidin-3-ylmethyl)quinoline-8-carboxamide.
| Compound Name | 2-methyl-N-(piperidin-3-ylmethyl)quinoline-8-carboxamide |
|---|---|
| PubChem CID | 119460242 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-methyl-N-(piperidin-3-ylmethyl)quinoline-8-carboxamide |
| SMILES | Cc1ccc2cccc(C(=O)NCC3CCCNC3)c2n1 |
| InChI | InChI=1S/C17H21N3O/c1-12-7-8-14-5-2-6-15(16(14)20-12)17(21)19-11-13-4-3-9-18-10-13/h2,5-8,13,18H,3-4,9-11H2,1H3,(H,19,21) |
| InChIKey | BUJADWGKKHZDAE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |