C13H27ClN4O2 — CID 119460747
2-(carbamoylamino)-N-(piperidin-3-ylmethyl)hexanamide;hydrochloride (PubChem CID 119460747) has the molecular formula C13H27ClN4O2 and a molecular weight of 306.84 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-(piperidin-3-ylmethyl)hexanamide;hydrochloride.
| Compound Name | 2-(carbamoylamino)-N-(piperidin-3-ylmethyl)hexanamide;hydrochloride |
|---|---|
| PubChem CID | 119460747 |
| Molecular Formula | C13H27ClN4O2 |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-(carbamoylamino)-N-(piperidin-3-ylmethyl)hexanamide;hydrochloride |
| SMILES | CCCCC(NC(N)=O)C(=O)NCC1CCCNC1.Cl |
| InChI | InChI=1S/C13H26N4O2.ClH/c1-2-3-6-11(17-13(14)19)12(18)16-9-10-5-4-7-15-8-10;/h10-11,15H,2-9H2,1H3,(H,16,18)(H3,14,17,19);1H |
| InChIKey | MDKAGAHPTLDCOA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |