C13H22ClN3O3S2 — CID 119461586
3-(dimethylsulfamoyl)-N-(piperidin-3-ylmethyl)thiophene-2-carboxamide;hydrochloride (PubChem CID 119461586) has the molecular formula C13H22ClN3O3S2 and a molecular weight of 367.92 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-(piperidin-3-ylmethyl)thiophene-2-carboxamide;hydrochloride.
| Compound Name | 3-(dimethylsulfamoyl)-N-(piperidin-3-ylmethyl)thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119461586 |
| Molecular Formula | C13H22ClN3O3S2 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-(piperidin-3-ylmethyl)thiophene-2-carboxamide;hydrochloride |
| SMILES | CN(C)S(=O)(=O)c1ccsc1C(=O)NCC1CCCNC1.Cl |
| InChI | InChI=1S/C13H21N3O3S2.ClH/c1-16(2)21(18,19)11-5-7-20-12(11)13(17)15-9-10-4-3-6-14-8-10;/h5,7,10,14H,3-4,6,8-9H2,1-2H3,(H,15,17);1H |
| InChIKey | MHLKEECFWMYDAL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |