C18H28ClN3O4S — CID 119462339
4-methoxy-N-(piperidin-3-ylmethyl)-3-pyrrolidin-1-ylsulfonylbenzamide;hydrochloride (PubChem CID 119462339) has the molecular formula C18H28ClN3O4S and a molecular weight of 417.96 g/mol. Its IUPAC name is 4-methoxy-N-(piperidin-3-ylmethyl)-3-pyrrolidin-1-ylsulfonylbenzamide;hydrochloride.
| Compound Name | 4-methoxy-N-(piperidin-3-ylmethyl)-3-pyrrolidin-1-ylsulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119462339 |
| Molecular Formula | C18H28ClN3O4S |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-methoxy-N-(piperidin-3-ylmethyl)-3-pyrrolidin-1-ylsulfonylbenzamide;hydrochloride |
| SMILES | COc1ccc(C(=O)NCC2CCCNC2)cc1S(=O)(=O)N1CCCC1.Cl |
| InChI | InChI=1S/C18H27N3O4S.ClH/c1-25-16-7-6-15(18(22)20-13-14-5-4-8-19-12-14)11-17(16)26(23,24)21-9-2-3-10-21;/h6-7,11,14,19H,2-5,8-10,12-13H2,1H3,(H,20,22);1H |
| InChIKey | RKPRNYUZCGGJRB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |