C16H26ClN3O4S — CID 120831442
4-methoxy-N-[2-(methylamino)propyl]-3-pyrrolidin-1-ylsulfonylbenzamide;hydrochloride (PubChem CID 120831442) has the molecular formula C16H26ClN3O4S and a molecular weight of 391.92 g/mol. Its IUPAC name is 4-methoxy-N-[2-(methylamino)propyl]-3-pyrrolidin-1-ylsulfonylbenzamide;hydrochloride.
| Compound Name | 4-methoxy-N-[2-(methylamino)propyl]-3-pyrrolidin-1-ylsulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 120831442 |
| Molecular Formula | C16H26ClN3O4S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 4-methoxy-N-[2-(methylamino)propyl]-3-pyrrolidin-1-ylsulfonylbenzamide;hydrochloride |
| SMILES | CNC(C)CNC(=O)c1ccc(OC)c(S(=O)(=O)N2CCCC2)c1.Cl |
| InChI | InChI=1S/C16H25N3O4S.ClH/c1-12(17-2)11-18-16(20)13-6-7-14(23-3)15(10-13)24(21,22)19-8-4-5-9-19;/h6-7,10,12,17H,4-5,8-9,11H2,1-3H3,(H,18,20);1H |
| InChIKey | SNQMDICSOLBIPT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |