C20H31N3O4S — CID 35121300
4-methoxy-N-[(2S)-1-piperidin-1-ylpropan-2-yl]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 35121300) has the molecular formula C20H31N3O4S and a molecular weight of 409.55 g/mol. Its IUPAC name is 4-methoxy-N-[(2S)-1-piperidin-1-ylpropan-2-yl]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 4-methoxy-N-[(2S)-1-piperidin-1-ylpropan-2-yl]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 35121300 |
| Molecular Formula | C20H31N3O4S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 4-methoxy-N-[(2S)-1-piperidin-1-ylpropan-2-yl]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(C(=O)N[C@@H](C)CN2CCCCC2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C20H31N3O4S/c1-16(15-22-10-4-3-5-11-22)21-20(24)17-8-9-18(27-2)19(14-17)28(25,26)23-12-6-7-13-23/h8-9,14,16H,3-7,10-13,15H2,1-2H3,(H,21,24)/t16-/m0/s1 |
| InChIKey | HLGKKXONYPKAGO-INIZCTEOSA-N |
| XLogP | 2.08 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |