C15H21FN2OS — CID 119462366
3-(2-fluorophenyl)sulfanyl-N-(piperidin-3-ylmethyl)propanamide (PubChem CID 119462366) has the molecular formula C15H21FN2OS and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-(2-fluorophenyl)sulfanyl-N-(piperidin-3-ylmethyl)propanamide.
| Compound Name | 3-(2-fluorophenyl)sulfanyl-N-(piperidin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 119462366 |
| Molecular Formula | C15H21FN2OS |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 3-(2-fluorophenyl)sulfanyl-N-(piperidin-3-ylmethyl)propanamide |
| SMILES | O=C(CCSc1ccccc1F)NCC1CCCNC1 |
| InChI | InChI=1S/C15H21FN2OS/c16-13-5-1-2-6-14(13)20-9-7-15(19)18-11-12-4-3-8-17-10-12/h1-2,5-6,12,17H,3-4,7-11H2,(H,18,19) |
| InChIKey | SXGSIXMPJWJEMC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |