C13H18ClF2N3O — CID 165430548
1-(2,6-difluorophenyl)-3-(piperidin-3-ylmethyl)urea;hydrochloride (PubChem CID 165430548) has the molecular formula C13H18ClF2N3O and a molecular weight of 305.76 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-(piperidin-3-ylmethyl)urea;hydrochloride.
| Compound Name | 1-(2,6-difluorophenyl)-3-(piperidin-3-ylmethyl)urea;hydrochloride |
|---|---|
| PubChem CID | 165430548 |
| Molecular Formula | C13H18ClF2N3O |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-(piperidin-3-ylmethyl)urea;hydrochloride |
| SMILES | Cl.O=C(NCC1CCCNC1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C13H17F2N3O.ClH/c14-10-4-1-5-11(15)12(10)18-13(19)17-8-9-3-2-6-16-7-9;/h1,4-5,9,16H,2-3,6-8H2,(H2,17,18,19);1H |
| InChIKey | HDOTWFYESHTTOG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |