C14H25ClN4O — CID 119463796
5-tert-butyl-N-(piperidin-3-ylmethyl)-1H-pyrazole-3-carboxamide;hydrochloride (PubChem CID 119463796) has the molecular formula C14H25ClN4O and a molecular weight of 300.83 g/mol. Its IUPAC name is 5-tert-butyl-N-(piperidin-3-ylmethyl)-1H-pyrazole-3-carboxamide;hydrochloride.
| Compound Name | 5-tert-butyl-N-(piperidin-3-ylmethyl)-1H-pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119463796 |
| Molecular Formula | C14H25ClN4O |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 5-tert-butyl-N-(piperidin-3-ylmethyl)-1H-pyrazole-3-carboxamide;hydrochloride |
| SMILES | CC(C)(C)c1cc(C(=O)NCC2CCCNC2)n[nH]1.Cl |
| InChI | InChI=1S/C14H24N4O.ClH/c1-14(2,3)12-7-11(17-18-12)13(19)16-9-10-5-4-6-15-8-10;/h7,10,15H,4-6,8-9H2,1-3H3,(H,16,19)(H,17,18);1H |
| InChIKey | KGRPTLXXGCMVBW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |