C16H20ClN3O3 — CID 119466891
3-[2-(aminomethyl)piperidine-1-carbonyl]-6-(furan-2-yl)-1H-pyridin-2-one;hydrochloride (PubChem CID 119466891) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is 3-[2-(aminomethyl)piperidine-1-carbonyl]-6-(furan-2-yl)-1H-pyridin-2-one;hydrochloride.
| Compound Name | 3-[2-(aminomethyl)piperidine-1-carbonyl]-6-(furan-2-yl)-1H-pyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119466891 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3-[2-(aminomethyl)piperidine-1-carbonyl]-6-(furan-2-yl)-1H-pyridin-2-one;hydrochloride |
| SMILES | Cl.NCC1CCCCN1C(=O)c1ccc(-c2ccco2)[nH]c1=O |
| InChI | InChI=1S/C16H19N3O3.ClH/c17-10-11-4-1-2-8-19(11)16(21)12-6-7-13(18-15(12)20)14-5-3-9-22-14;/h3,5-7,9,11H,1-2,4,8,10,17H2,(H,18,20);1H |
| InChIKey | IJNODWNGOMMXQH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |