C18H21N3O3 — CID 95977450
3-[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl]-6-(furan-2-yl)-1H-pyridin-2-one (PubChem CID 95977450) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl]-6-(furan-2-yl)-1H-pyridin-2-one.
| Compound Name | 3-[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl]-6-(furan-2-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 95977450 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3-[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl]-6-(furan-2-yl)-1H-pyridin-2-one |
| SMILES | O=C(c1ccc(-c2ccco2)[nH]c1=O)N1CCN2CCCC[C@H]2C1 |
| InChI | InChI=1S/C18H21N3O3/c22-17-14(6-7-15(19-17)16-5-3-11-24-16)18(23)21-10-9-20-8-2-1-4-13(20)12-21/h3,5-7,11,13H,1-2,4,8-10,12H2,(H,19,22)/t13-/m0/s1 |
| InChIKey | UDGURGVIGAECES-ZDUSSCGKSA-N |
| XLogP | 1.95 |
| TPSA | 69.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |