C22H30N2O4 — CID 11946747
(4S)-4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-1-(2,4-dimethoxyphenyl)pyrrolidin-2-one (PubChem CID 11946747) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is (4S)-4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-1-(2,4-dimethoxyphenyl)pyrrolidin-2-one.
| Compound Name | (4S)-4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-1-(2,4-dimethoxyphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 11946747 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | (4S)-4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-1-(2,4-dimethoxyphenyl)pyrrolidin-2-one |
| SMILES | COc1ccc(N2C[C@@H](C(=O)N3CCC[C@H]4CCCC[C@@H]43)CC2=O)c(OC)c1 |
| InChI | InChI=1S/C22H30N2O4/c1-27-17-9-10-19(20(13-17)28-2)24-14-16(12-21(24)25)22(26)23-11-5-7-15-6-3-4-8-18(15)23/h9-10,13,15-16,18H,3-8,11-12,14H2,1-2H3/t15-,16+,18+/m1/s1 |
| InChIKey | GASJYRMVQPDDAU-RYRKJORJSA-N |
| XLogP | 3.24 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |