C22H30N2O3 — CID 51125887
1-(4-methoxyphenyl)-4-(6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)pyrrolidin-2-one (PubChem CID 51125887) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-(6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-(4-methoxyphenyl)-4-(6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 51125887 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-(6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)pyrrolidin-2-one |
| SMILES | COc1ccc(N2CC(C(=O)N3CCCC4CC(C)CCC43)CC2=O)cc1 |
| InChI | InChI=1S/C22H30N2O3/c1-15-5-10-20-16(12-15)4-3-11-23(20)22(26)17-13-21(25)24(14-17)18-6-8-19(27-2)9-7-18/h6-9,15-17,20H,3-5,10-14H2,1-2H3 |
| InChIKey | WSWRQYRJHVBYDA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |