C18H21FN4O2 — CID 119468055
3-[2-(aminomethyl)piperidine-1-carbonyl]-1-(2-fluorophenyl)-6-methylpyridazin-4-one (PubChem CID 119468055) has the molecular formula C18H21FN4O2 and a molecular weight of 344.39 g/mol. Its IUPAC name is 3-[2-(aminomethyl)piperidine-1-carbonyl]-1-(2-fluorophenyl)-6-methylpyridazin-4-one.
| Compound Name | 3-[2-(aminomethyl)piperidine-1-carbonyl]-1-(2-fluorophenyl)-6-methylpyridazin-4-one |
|---|---|
| PubChem CID | 119468055 |
| Molecular Formula | C18H21FN4O2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 3-[2-(aminomethyl)piperidine-1-carbonyl]-1-(2-fluorophenyl)-6-methylpyridazin-4-one |
| SMILES | Cc1cc(=O)c(C(=O)N2CCCCC2CN)nn1-c1ccccc1F |
| InChI | InChI=1S/C18H21FN4O2/c1-12-10-16(24)17(18(25)22-9-5-4-6-13(22)11-20)21-23(12)15-8-3-2-7-14(15)19/h2-3,7-8,10,13H,4-6,9,11,20H2,1H3 |
| InChIKey | VPGVSZDRHDDWIK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |