C22H20ClN3O2 — CID 43041687
1-(2-chlorophenyl)-6-methyl-3-(2-phenylpyrrolidine-1-carbonyl)pyridazin-4-one (PubChem CID 43041687) has the molecular formula C22H20ClN3O2 and a molecular weight of 393.87 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-6-methyl-3-(2-phenylpyrrolidine-1-carbonyl)pyridazin-4-one.
| Compound Name | 1-(2-chlorophenyl)-6-methyl-3-(2-phenylpyrrolidine-1-carbonyl)pyridazin-4-one |
|---|---|
| PubChem CID | 43041687 |
| Molecular Formula | C22H20ClN3O2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1-(2-chlorophenyl)-6-methyl-3-(2-phenylpyrrolidine-1-carbonyl)pyridazin-4-one |
| SMILES | Cc1cc(=O)c(C(=O)N2CCCC2c2ccccc2)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C22H20ClN3O2/c1-15-14-20(27)21(24-26(15)19-11-6-5-10-17(19)23)22(28)25-13-7-12-18(25)16-8-3-2-4-9-16/h2-6,8-11,14,18H,7,12-13H2,1H3 |
| InChIKey | DJSYXSRMKHRONT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |