C16H14Cl2N2O — CID 30417532
(3,6-dichloro-2-pyridinyl)-[(2R)-2-phenylpyrrolidin-1-yl]methanone (PubChem CID 30417532) has the molecular formula C16H14Cl2N2O and a molecular weight of 321.21 g/mol. Its IUPAC name is (3,6-dichloro-2-pyridinyl)-[(2R)-2-phenylpyrrolidin-1-yl]methanone.
| Compound Name | (3,6-dichloro-2-pyridinyl)-[(2R)-2-phenylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 30417532 |
| Molecular Formula | C16H14Cl2N2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | (3,6-dichloro-2-pyridinyl)-[(2R)-2-phenylpyrrolidin-1-yl]methanone |
| SMILES | O=C(c1nc(Cl)ccc1Cl)N1CCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H14Cl2N2O/c17-12-8-9-14(18)19-15(12)16(21)20-10-4-7-13(20)11-5-2-1-3-6-11/h1-3,5-6,8-9,13H,4,7,10H2/t13-/m1/s1 |
| InChIKey | FFYLBJYWPZLJNQ-CYBMUJFWSA-N |
| XLogP | 4.37 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|