C18H17Cl2NO2 — CID 43048100
(3,5-dichloro-4-methoxyphenyl)-(2-phenylpyrrolidin-1-yl)methanone (PubChem CID 43048100) has the molecular formula C18H17Cl2NO2 and a molecular weight of 350.25 g/mol. Its IUPAC name is (3,5-dichloro-4-methoxyphenyl)-(2-phenylpyrrolidin-1-yl)methanone.
| Compound Name | (3,5-dichloro-4-methoxyphenyl)-(2-phenylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 43048100 |
| Molecular Formula | C18H17Cl2NO2 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | (3,5-dichloro-4-methoxyphenyl)-(2-phenylpyrrolidin-1-yl)methanone |
| SMILES | COc1c(Cl)cc(C(=O)N2CCCC2c2ccccc2)cc1Cl |
| InChI | InChI=1S/C18H17Cl2NO2/c1-23-17-14(19)10-13(11-15(17)20)18(22)21-9-5-8-16(21)12-6-3-2-4-7-12/h2-4,6-7,10-11,16H,5,8-9H2,1H3 |
| InChIKey | IJKAMGSUQCJXSH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |