C18H16ClNO3 — CID 24658230
(7-chloro-1,3-benzodioxol-5-yl)-(2-phenylpyrrolidin-1-yl)methanone (PubChem CID 24658230) has the molecular formula C18H16ClNO3 and a molecular weight of 329.78 g/mol. Its IUPAC name is (7-chloro-1,3-benzodioxol-5-yl)-(2-phenylpyrrolidin-1-yl)methanone.
| Compound Name | (7-chloro-1,3-benzodioxol-5-yl)-(2-phenylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 24658230 |
| Molecular Formula | C18H16ClNO3 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | (7-chloro-1,3-benzodioxol-5-yl)-(2-phenylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cc(Cl)c2c(c1)OCO2)N1CCCC1c1ccccc1 |
| InChI | InChI=1S/C18H16ClNO3/c19-14-9-13(10-16-17(14)23-11-22-16)18(21)20-8-4-7-15(20)12-5-2-1-3-6-12/h1-3,5-6,9-10,15H,4,7-8,11H2 |
| InChIKey | DSWBZXZJPUDAMN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |