C15H20ClF3N2O2 — CID 119468531
1-[2-(aminomethyl)piperidin-1-yl]-2-[4-(trifluoromethyl)phenoxy]ethanone;hydrochloride (PubChem CID 119468531) has the molecular formula C15H20ClF3N2O2 and a molecular weight of 352.78 g/mol. Its IUPAC name is 1-[2-(aminomethyl)piperidin-1-yl]-2-[4-(trifluoromethyl)phenoxy]ethanone;hydrochloride.
| Compound Name | 1-[2-(aminomethyl)piperidin-1-yl]-2-[4-(trifluoromethyl)phenoxy]ethanone;hydrochloride |
|---|---|
| PubChem CID | 119468531 |
| Molecular Formula | C15H20ClF3N2O2 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[2-(aminomethyl)piperidin-1-yl]-2-[4-(trifluoromethyl)phenoxy]ethanone;hydrochloride |
| SMILES | Cl.NCC1CCCCN1C(=O)COc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3N2O2.ClH/c16-15(17,18)11-4-6-13(7-5-11)22-10-14(21)20-8-2-1-3-12(20)9-19;/h4-7,12H,1-3,8-10,19H2;1H |
| InChIKey | JSSGREQBONTLSK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |