C17H22FNO4 — CID 70735433
ethyl 2-[1-[2-(4-fluorophenoxy)acetyl]piperidin-2-yl]acetate (PubChem CID 70735433) has the molecular formula C17H22FNO4 and a molecular weight of 323.36 g/mol. Its IUPAC name is ethyl 2-[1-[2-(4-fluorophenoxy)acetyl]piperidin-2-yl]acetate.
| Compound Name | ethyl 2-[1-[2-(4-fluorophenoxy)acetyl]piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 70735433 |
| Molecular Formula | C17H22FNO4 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | ethyl 2-[1-[2-(4-fluorophenoxy)acetyl]piperidin-2-yl]acetate |
| SMILES | CCOC(=O)CC1CCCCN1C(=O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C17H22FNO4/c1-2-22-17(21)11-14-5-3-4-10-19(14)16(20)12-23-15-8-6-13(18)7-9-15/h6-9,14H,2-5,10-12H2,1H3 |
| InChIKey | UFMKHUAQZYMOBD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |