C18H20F2N2O2S — CID 119468773
[2-(aminomethyl)piperidin-1-yl]-[5-[4-(difluoromethoxy)phenyl]thiophen-2-yl]methanone (PubChem CID 119468773) has the molecular formula C18H20F2N2O2S and a molecular weight of 366.43 g/mol. Its IUPAC name is [2-(aminomethyl)piperidin-1-yl]-[5-[4-(difluoromethoxy)phenyl]thiophen-2-yl]methanone.
| Compound Name | [2-(aminomethyl)piperidin-1-yl]-[5-[4-(difluoromethoxy)phenyl]thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 119468773 |
| Molecular Formula | C18H20F2N2O2S |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [2-(aminomethyl)piperidin-1-yl]-[5-[4-(difluoromethoxy)phenyl]thiophen-2-yl]methanone |
| SMILES | NCC1CCCCN1C(=O)c1ccc(-c2ccc(OC(F)F)cc2)s1 |
| InChI | InChI=1S/C18H20F2N2O2S/c19-18(20)24-14-6-4-12(5-7-14)15-8-9-16(25-15)17(23)22-10-2-1-3-13(22)11-21/h4-9,13,18H,1-3,10-11,21H2 |
| InChIKey | JYPIDSWYMWCMPP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |