C24H24N2O3 — CID 11947051
4-[(3aS,4S,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3,5-dimethylphenyl)benzamide (PubChem CID 11947051) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-[(3aS,4S,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3,5-dimethylphenyl)benzamide.
| Compound Name | 4-[(3aS,4S,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3,5-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 11947051 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 4-[(3aS,4S,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3,5-dimethylphenyl)benzamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2ccc(N3C(=O)[C@@H]4[C@H](CC=C[C@@H]4C)C3=O)cc2)c1 |
| InChI | InChI=1S/C24H24N2O3/c1-14-11-15(2)13-18(12-14)25-22(27)17-7-9-19(10-8-17)26-23(28)20-6-4-5-16(3)21(20)24(26)29/h4-5,7-13,16,20-21H,6H2,1-3H3,(H,25,27)/t16-,20-,21-/m0/s1 |
| InChIKey | IRCAHNQMDNYJAC-NDXORKPFSA-N |
| XLogP | 4.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|