C11H19ClN4O3 — CID 119470881
1-methyl-3-[2-(2-methylpiperazin-1-yl)-2-oxoethyl]imidazolidine-2,4-dione;hydrochloride (PubChem CID 119470881) has the molecular formula C11H19ClN4O3 and a molecular weight of 290.75 g/mol. Its IUPAC name is 1-methyl-3-[2-(2-methylpiperazin-1-yl)-2-oxoethyl]imidazolidine-2,4-dione;hydrochloride.
| Compound Name | 1-methyl-3-[2-(2-methylpiperazin-1-yl)-2-oxoethyl]imidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 119470881 |
| Molecular Formula | C11H19ClN4O3 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-methyl-3-[2-(2-methylpiperazin-1-yl)-2-oxoethyl]imidazolidine-2,4-dione;hydrochloride |
| SMILES | CC1CNCCN1C(=O)CN1C(=O)CN(C)C1=O.Cl |
| InChI | InChI=1S/C11H18N4O3.ClH/c1-8-5-12-3-4-14(8)10(17)7-15-9(16)6-13(2)11(15)18;/h8,12H,3-7H2,1-2H3;1H |
| InChIKey | YMHYYXMKVYTACY-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|