C15H21ClN4O3 — CID 119471146
[4-(cyclopropylamino)-3-nitrophenyl]-(2-methylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 119471146) has the molecular formula C15H21ClN4O3 and a molecular weight of 340.81 g/mol. Its IUPAC name is [4-(cyclopropylamino)-3-nitrophenyl]-(2-methylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | [4-(cyclopropylamino)-3-nitrophenyl]-(2-methylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119471146 |
| Molecular Formula | C15H21ClN4O3 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [4-(cyclopropylamino)-3-nitrophenyl]-(2-methylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | CC1CNCCN1C(=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C15H20N4O3.ClH/c1-10-9-16-6-7-18(10)15(20)11-2-5-13(17-12-3-4-12)14(8-11)19(21)22;/h2,5,8,10,12,16-17H,3-4,6-7,9H2,1H3;1H |
| InChIKey | NXBPSKVHCAEAKF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|