C21H24N4O3 — CID 99811132
[4-(cyclopropylamino)-3-nitrophenyl]-[(4R)-1,4-dimethyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl]methanone (PubChem CID 99811132) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is [4-(cyclopropylamino)-3-nitrophenyl]-[(4R)-1,4-dimethyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl]methanone.
| Compound Name | [4-(cyclopropylamino)-3-nitrophenyl]-[(4R)-1,4-dimethyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl]methanone |
|---|---|
| PubChem CID | 99811132 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [4-(cyclopropylamino)-3-nitrophenyl]-[(4R)-1,4-dimethyl-3,4-dihydro-2H-1,5-benzodiazepin-5-yl]methanone |
| SMILES | C[C@@H]1CCN(C)c2ccccc2N1C(=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H24N4O3/c1-14-11-12-23(2)18-5-3-4-6-19(18)24(14)21(26)15-7-10-17(22-16-8-9-16)20(13-15)25(27)28/h3-7,10,13-14,16,22H,8-9,11-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | HTCFNZUROHCHSE-CQSZACIVSA-N |
| XLogP | 4.04 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|