C11H17N3O4S — CID 119473665
2-methyl-5-(2-methylpiperazine-1-carbonyl)furan-3-sulfonamide (PubChem CID 119473665) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-methyl-5-(2-methylpiperazine-1-carbonyl)furan-3-sulfonamide.
| Compound Name | 2-methyl-5-(2-methylpiperazine-1-carbonyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 119473665 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-methyl-5-(2-methylpiperazine-1-carbonyl)furan-3-sulfonamide |
| SMILES | Cc1oc(C(=O)N2CCNCC2C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H17N3O4S/c1-7-6-13-3-4-14(7)11(15)9-5-10(8(2)18-9)19(12,16)17/h5,7,13H,3-4,6H2,1-2H3,(H2,12,16,17) |
| InChIKey | WJWARCUVNHBBQO-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |