C18H28N2OS — CID 119476399
N-(4-aminocyclohexyl)-2-(4-tert-butylphenyl)sulfanylacetamide (PubChem CID 119476399) has the molecular formula C18H28N2OS and a molecular weight of 320.50 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-(4-tert-butylphenyl)sulfanylacetamide.
| Compound Name | N-(4-aminocyclohexyl)-2-(4-tert-butylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 119476399 |
| Molecular Formula | C18H28N2OS |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-(4-tert-butylphenyl)sulfanylacetamide |
| SMILES | CC(C)(C)c1ccc(SCC(=O)NC2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C18H28N2OS/c1-18(2,3)13-4-10-16(11-5-13)22-12-17(21)20-15-8-6-14(19)7-9-15/h4-5,10-11,14-15H,6-9,12,19H2,1-3H3,(H,20,21) |
| InChIKey | MXWCMMRLLWXDTI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |