C26H34N2O3S — CID 112807627
2-(4-tert-butylphenyl)sulfanyl-N-[1-(4-ethoxybenzoyl)piperidin-4-yl]acetamide (PubChem CID 112807627) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)sulfanyl-N-[1-(4-ethoxybenzoyl)piperidin-4-yl]acetamide.
| Compound Name | 2-(4-tert-butylphenyl)sulfanyl-N-[1-(4-ethoxybenzoyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 112807627 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 2-(4-tert-butylphenyl)sulfanyl-N-[1-(4-ethoxybenzoyl)piperidin-4-yl]acetamide |
| SMILES | CCOc1ccc(C(=O)N2CCC(NC(=O)CSc3ccc(C(C)(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H34N2O3S/c1-5-31-22-10-6-19(7-11-22)25(30)28-16-14-21(15-17-28)27-24(29)18-32-23-12-8-20(9-13-23)26(2,3)4/h6-13,21H,5,14-18H2,1-4H3,(H,27,29) |
| InChIKey | VNEPFMVTJKXMPB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |