C13H27Cl2N3O2 — CID 119477299
N-(4-aminocyclohexyl)-4-ethylmorpholine-2-carboxamide;dihydrochloride (PubChem CID 119477299) has the molecular formula C13H27Cl2N3O2 and a molecular weight of 328.28 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-4-ethylmorpholine-2-carboxamide;dihydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-4-ethylmorpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119477299 |
| Molecular Formula | C13H27Cl2N3O2 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-(4-aminocyclohexyl)-4-ethylmorpholine-2-carboxamide;dihydrochloride |
| SMILES | CCN1CCOC(C(=O)NC2CCC(N)CC2)C1.Cl.Cl |
| InChI | InChI=1S/C13H25N3O2.2ClH/c1-2-16-7-8-18-12(9-16)13(17)15-11-5-3-10(14)4-6-11;;/h10-12H,2-9,14H2,1H3,(H,15,17);2*1H |
| InChIKey | VRDVDPLJQFDMJP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |