C15H18F2N2O2 — CID 155981047
N-cyclopropyl-4-[(3,4-difluorophenyl)methyl]morpholine-2-carboxamide (PubChem CID 155981047) has the molecular formula C15H18F2N2O2 and a molecular weight of 296.32 g/mol. Its IUPAC name is N-cyclopropyl-4-[(3,4-difluorophenyl)methyl]morpholine-2-carboxamide.
| Compound Name | N-cyclopropyl-4-[(3,4-difluorophenyl)methyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 155981047 |
| Molecular Formula | C15H18F2N2O2 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-cyclopropyl-4-[(3,4-difluorophenyl)methyl]morpholine-2-carboxamide |
| SMILES | O=C(NC1CC1)C1CN(Cc2ccc(F)c(F)c2)CCO1 |
| InChI | InChI=1S/C15H18F2N2O2/c16-12-4-1-10(7-13(12)17)8-19-5-6-21-14(9-19)15(20)18-11-2-3-11/h1,4,7,11,14H,2-3,5-6,8-9H2,(H,18,20) |
| InChIKey | VNLOMAUFTUHYFH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |