C18H22F2N2O2 — CID 97461442
(3aR,5S,7aR)-N-cyclopropyl-1-[(3,4-difluorophenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide (PubChem CID 97461442) has the molecular formula C18H22F2N2O2 and a molecular weight of 336.38 g/mol. Its IUPAC name is (3aR,5S,7aR)-N-cyclopropyl-1-[(3,4-difluorophenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide.
| Compound Name | (3aR,5S,7aR)-N-cyclopropyl-1-[(3,4-difluorophenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 97461442 |
| Molecular Formula | C18H22F2N2O2 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (3aR,5S,7aR)-N-cyclopropyl-1-[(3,4-difluorophenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
| SMILES | O=C(NC1CC1)[C@@H]1CC[C@@H]2[C@@H](CCN2Cc2ccc(F)c(F)c2)O1 |
| InChI | InChI=1S/C18H22F2N2O2/c19-13-4-1-11(9-14(13)20)10-22-8-7-16-15(22)5-6-17(24-16)18(23)21-12-2-3-12/h1,4,9,12,15-17H,2-3,5-8,10H2,(H,21,23)/t15-,16-,17+/m1/s1 |
| InChIKey | FUZFSYXQMHIQEO-ZACQAIPSSA-N |
| XLogP | 2.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |