C17H20N4O3 — CID 97364954
(3aR,5R,7aR)-1-(furan-3-ylmethyl)-N-pyrazin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide (PubChem CID 97364954) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is (3aR,5R,7aR)-1-(furan-3-ylmethyl)-N-pyrazin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide.
| Compound Name | (3aR,5R,7aR)-1-(furan-3-ylmethyl)-N-pyrazin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 97364954 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (3aR,5R,7aR)-1-(furan-3-ylmethyl)-N-pyrazin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
| SMILES | O=C(Nc1cnccn1)[C@H]1CC[C@@H]2[C@@H](CCN2Cc2ccoc2)O1 |
| InChI | InChI=1S/C17H20N4O3/c22-17(20-16-9-18-5-6-19-16)15-2-1-13-14(24-15)3-7-21(13)10-12-4-8-23-11-12/h4-6,8-9,11,13-15H,1-3,7,10H2,(H,19,20,22)/t13-,14-,15-/m1/s1 |
| InChIKey | ATNOGOSKBPMBAU-RBSFLKMASA-N |
| XLogP | 1.83 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |