C17H22N4O3 — CID 97378354
(2S,3aR,6aR)-4-(furan-3-ylmethyl)-N-[(1-methylimidazol-2-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide (PubChem CID 97378354) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is (2S,3aR,6aR)-4-(furan-3-ylmethyl)-N-[(1-methylimidazol-2-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide.
| Compound Name | (2S,3aR,6aR)-4-(furan-3-ylmethyl)-N-[(1-methylimidazol-2-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97378354 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (2S,3aR,6aR)-4-(furan-3-ylmethyl)-N-[(1-methylimidazol-2-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide |
| SMILES | Cn1ccnc1CNC(=O)[C@@H]1C[C@@H]2[C@@H](CCN2Cc2ccoc2)O1 |
| InChI | InChI=1S/C17H22N4O3/c1-20-6-4-18-16(20)9-19-17(22)15-8-13-14(24-15)2-5-21(13)10-12-3-7-23-11-12/h3-4,6-7,11,13-15H,2,5,8-10H2,1H3,(H,19,22)/t13-,14-,15+/m1/s1 |
| InChIKey | GSGIJEIZSARBJI-KFWWJZLASA-N |
| XLogP | 1.06 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |