C21H27N3O2 — CID 97461444
(3aR,5S,7aR)-N-cyclopropyl-1-[(1-methylindol-3-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide (PubChem CID 97461444) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is (3aR,5S,7aR)-N-cyclopropyl-1-[(1-methylindol-3-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide.
| Compound Name | (3aR,5S,7aR)-N-cyclopropyl-1-[(1-methylindol-3-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 97461444 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | (3aR,5S,7aR)-N-cyclopropyl-1-[(1-methylindol-3-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
| SMILES | Cn1cc(CN2CC[C@H]3O[C@H](C(=O)NC4CC4)CC[C@H]32)c2ccccc21 |
| InChI | InChI=1S/C21H27N3O2/c1-23-12-14(16-4-2-3-5-17(16)23)13-24-11-10-19-18(24)8-9-20(26-19)21(25)22-15-6-7-15/h2-5,12,15,18-20H,6-11,13H2,1H3,(H,22,25)/t18-,19-,20+/m1/s1 |
| InChIKey | UVCCCGVERARQJU-AQNXPRMDSA-N |
| XLogP | 2.58 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |