C20H25F2N3O — CID 118784005
(1S,2R,3S,4R)-3-amino-N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 118784005) has the molecular formula C20H25F2N3O and a molecular weight of 361.44 g/mol. Its IUPAC name is (1S,2R,3S,4R)-3-amino-N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2R,3S,4R)-3-amino-N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 118784005 |
| Molecular Formula | C20H25F2N3O |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (1S,2R,3S,4R)-3-amino-N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | N[C@@H]1[C@H](C(=O)NC2CCN(Cc3ccc(F)c(F)c3)CC2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C20H25F2N3O/c21-16-4-1-12(9-17(16)22)11-25-7-5-15(6-8-25)24-20(26)18-13-2-3-14(10-13)19(18)23/h1-4,9,13-15,18-19H,5-8,10-11,23H2,(H,24,26)/t13-,14+,18-,19+/m1/s1 |
| InChIKey | YGDSJAVNSUKJEG-CFGMGRTJSA-N |
| XLogP | 2.19 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|