C21H31N3O2 — CID 95851830
(2S)-N-cyclopentyl-4-[(1-ethyl-2,3-dihydroindol-5-yl)methyl]morpholine-2-carboxamide (PubChem CID 95851830) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is (2S)-N-cyclopentyl-4-[(1-ethyl-2,3-dihydroindol-5-yl)methyl]morpholine-2-carboxamide.
| Compound Name | (2S)-N-cyclopentyl-4-[(1-ethyl-2,3-dihydroindol-5-yl)methyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 95851830 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | (2S)-N-cyclopentyl-4-[(1-ethyl-2,3-dihydroindol-5-yl)methyl]morpholine-2-carboxamide |
| SMILES | CCN1CCc2cc(CN3CCO[C@H](C(=O)NC4CCCC4)C3)ccc21 |
| InChI | InChI=1S/C21H31N3O2/c1-2-24-10-9-17-13-16(7-8-19(17)24)14-23-11-12-26-20(15-23)21(25)22-18-5-3-4-6-18/h7-8,13,18,20H,2-6,9-12,14-15H2,1H3,(H,22,25)/t20-/m0/s1 |
| InChIKey | MEKPDPRBLKRAFY-FQEVSTJZSA-N |
| XLogP | 2.33 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|