C21H27ClN2O2 — CID 119478339
N-(4-aminocyclohexyl)-2-[(2-methylphenyl)methoxy]benzamide;hydrochloride (PubChem CID 119478339) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-[(2-methylphenyl)methoxy]benzamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-2-[(2-methylphenyl)methoxy]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119478339 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-[(2-methylphenyl)methoxy]benzamide;hydrochloride |
| SMILES | Cc1ccccc1COc1ccccc1C(=O)NC1CCC(N)CC1.Cl |
| InChI | InChI=1S/C21H26N2O2.ClH/c1-15-6-2-3-7-16(15)14-25-20-9-5-4-8-19(20)21(24)23-18-12-10-17(22)11-13-18;/h2-9,17-18H,10-14,22H2,1H3,(H,23,24);1H |
| InChIKey | ACIILFVAQQJXKO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |