C20H25ClN2O2 — CID 119616996
N-(2-amino-1-cyclopropylethyl)-2-[(2-methylphenyl)methoxy]benzamide;hydrochloride (PubChem CID 119616996) has the molecular formula C20H25ClN2O2 and a molecular weight of 360.89 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-2-[(2-methylphenyl)methoxy]benzamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-2-[(2-methylphenyl)methoxy]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119616996 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-2-[(2-methylphenyl)methoxy]benzamide;hydrochloride |
| SMILES | Cc1ccccc1COc1ccccc1C(=O)NC(CN)C1CC1.Cl |
| InChI | InChI=1S/C20H24N2O2.ClH/c1-14-6-2-3-7-16(14)13-24-19-9-5-4-8-17(19)20(23)22-18(12-21)15-10-11-15;/h2-9,15,18H,10-13,21H2,1H3,(H,22,23);1H |
| InChIKey | QZRPYODXYKSHHN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |