C38H39F3N6O2 — CID 11947936
3-[8-(2,6-difluorophenyl)-7-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-4-yl]-N-[2-(4-fluorophenyl)ethyl]-4-methylbenzamide (PubChem CID 11947936) has the molecular formula C38H39F3N6O2 and a molecular weight of 668.76 g/mol. Its IUPAC name is 3-[8-(2,6-difluorophenyl)-7-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-4-yl]-N-[2-(4-fluorophenyl)ethyl]-4-methylbenzamide.
| Compound Name | 3-[8-(2,6-difluorophenyl)-7-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-4-yl]-N-[2-(4-fluorophenyl)ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 11947936 |
| Molecular Formula | C38H39F3N6O2 |
| Molecular Weight | 668.76 g/mol |
| Exact Mass | 668.31 |
| IUPAC Name | 3-[8-(2,6-difluorophenyl)-7-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-4-yl]-N-[2-(4-fluorophenyl)ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCc2ccc(F)cc2)cc1-c1nc(NC2CC(C)(C)NC(C)(C)C2)nc2c1ccc(=O)n2-c1c(F)cccc1F |
| InChI | InChI=1S/C38H39F3N6O2/c1-22-9-12-24(35(49)42-18-17-23-10-13-25(39)14-11-23)19-28(22)32-27-15-16-31(48)47(33-29(40)7-6-8-30(33)41)34(27)45-36(44-32)43-26-20-37(2,3)46-38(4,5)21-26/h6-16,19,26,46H,17-18,20-21H2,1-5H3,(H,42,49)(H,43,44,45) |
| InChIKey | JUQGXLOBQQNDRL-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.76 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |