C21H17O7P — CID 11947948
[9-(4-methoxy-2-methylphenyl)-6-oxoxanthen-3-yl] dihydrogen phosphate (PubChem CID 11947948) has the molecular formula C21H17O7P and a molecular weight of 412.33 g/mol. Its IUPAC name is [9-(4-methoxy-2-methylphenyl)-6-oxoxanthen-3-yl] dihydrogen phosphate.
| Compound Name | [9-(4-methoxy-2-methylphenyl)-6-oxoxanthen-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 11947948 |
| Molecular Formula | C21H17O7P |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | [9-(4-methoxy-2-methylphenyl)-6-oxoxanthen-3-yl] dihydrogen phosphate |
| SMILES | COc1ccc(-c2c3ccc(=O)cc-3oc3cc(OP(=O)(O)O)ccc23)c(C)c1 |
| InChI | InChI=1S/C21H17O7P/c1-12-9-14(26-2)4-7-16(12)21-17-6-3-13(22)10-19(17)27-20-11-15(5-8-18(20)21)28-29(23,24)25/h3-11H,1-2H3,(H2,23,24,25) |
| InChIKey | OLWRHXNPCCRHCB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|