C19H28N4O3 — CID 119481429
N-(2-aminoethyl)-1-[4-(2-methylpropanoylamino)benzoyl]piperidine-3-carboxamide (PubChem CID 119481429) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[4-(2-methylpropanoylamino)benzoyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[4-(2-methylpropanoylamino)benzoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119481429 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | N-(2-aminoethyl)-1-[4-(2-methylpropanoylamino)benzoyl]piperidine-3-carboxamide |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)N2CCCC(C(=O)NCCN)C2)cc1 |
| InChI | InChI=1S/C19H28N4O3/c1-13(2)17(24)22-16-7-5-14(6-8-16)19(26)23-11-3-4-15(12-23)18(25)21-10-9-20/h5-8,13,15H,3-4,9-12,20H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | BJOQYBWKAGFYJF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |