C15H26N4O3 — CID 119481485
N-(2-aminoethyl)-1-[2-(2-oxopiperidin-1-yl)acetyl]piperidine-3-carboxamide (PubChem CID 119481485) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[2-(2-oxopiperidin-1-yl)acetyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[2-(2-oxopiperidin-1-yl)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119481485 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | N-(2-aminoethyl)-1-[2-(2-oxopiperidin-1-yl)acetyl]piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(C(=O)CN2CCCCC2=O)C1 |
| InChI | InChI=1S/C15H26N4O3/c16-6-7-17-15(22)12-4-3-9-18(10-12)14(21)11-19-8-2-1-5-13(19)20/h12H,1-11,16H2,(H,17,22) |
| InChIKey | ZVHXZKQKHSLADZ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |