C17H30N4O3 — CID 119482275
N-(2-aminoethyl)-1-[2-(2-oxoazocan-1-yl)acetyl]piperidine-3-carboxamide (PubChem CID 119482275) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[2-(2-oxoazocan-1-yl)acetyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[2-(2-oxoazocan-1-yl)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119482275 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | N-(2-aminoethyl)-1-[2-(2-oxoazocan-1-yl)acetyl]piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(C(=O)CN2CCCCCCC2=O)C1 |
| InChI | InChI=1S/C17H30N4O3/c18-8-9-19-17(24)14-6-5-11-20(12-14)16(23)13-21-10-4-2-1-3-7-15(21)22/h14H,1-13,18H2,(H,19,24) |
| InChIKey | IDVHWCPUNPUUMN-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |