C14H23NO2 — CID 11948265
(2Z,4R,5S)-4,5-dimethyl-3-[(2R)-2-methylpyrrolidin-1-yl]hepta-2,6-dienoic acid (PubChem CID 11948265) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is (2Z,4R,5S)-4,5-dimethyl-3-[(2R)-2-methylpyrrolidin-1-yl]hepta-2,6-dienoic acid.
| Compound Name | (2Z,4R,5S)-4,5-dimethyl-3-[(2R)-2-methylpyrrolidin-1-yl]hepta-2,6-dienoic acid |
|---|---|
| PubChem CID | 11948265 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (2Z,4R,5S)-4,5-dimethyl-3-[(2R)-2-methylpyrrolidin-1-yl]hepta-2,6-dienoic acid |
| SMILES | C=C[C@H](C)[C@@H](C)/C(=C/C(=O)O)N1CCC[C@H]1C |
| InChI | InChI=1S/C14H23NO2/c1-5-10(2)12(4)13(9-14(16)17)15-8-6-7-11(15)3/h5,9-12H,1,6-8H2,2-4H3,(H,16,17)/b13-9-/t10-,11+,12+/m0/s1 |
| InChIKey | LFJCTHYBSJIKJL-KNGSCNOGSA-N |
| XLogP | 2.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|