C13H24N2O — CID 170955387
2-[ethenyl(methyl)amino]-3-methyl-1-(2-methylpyrrolidin-1-yl)butan-1-one (PubChem CID 170955387) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-[ethenyl(methyl)amino]-3-methyl-1-(2-methylpyrrolidin-1-yl)butan-1-one.
| Compound Name | 2-[ethenyl(methyl)amino]-3-methyl-1-(2-methylpyrrolidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 170955387 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 2-[ethenyl(methyl)amino]-3-methyl-1-(2-methylpyrrolidin-1-yl)butan-1-one |
| SMILES | C=CN(C)C(C(=O)N1CCCC1C)C(C)C |
| InChI | InChI=1S/C13H24N2O/c1-6-14(5)12(10(2)3)13(16)15-9-7-8-11(15)4/h6,10-12H,1,7-9H2,2-5H3 |
| InChIKey | WSKSJRYBPDWSQS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |