C34H34F2N6O2S — CID 11948276
N-[3-[8-(2,6-difluorophenyl)-7-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-4-yl]-4-methylphenyl]thiophene-2-carboxamide (PubChem CID 11948276) has the molecular formula C34H34F2N6O2S and a molecular weight of 628.75 g/mol. Its IUPAC name is N-[3-[8-(2,6-difluorophenyl)-7-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-4-yl]-4-methylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[8-(2,6-difluorophenyl)-7-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-4-yl]-4-methylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 11948276 |
| Molecular Formula | C34H34F2N6O2S |
| Molecular Weight | 628.75 g/mol |
| Exact Mass | 628.24 |
| IUPAC Name | N-[3-[8-(2,6-difluorophenyl)-7-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[2,3-d]pyrimidin-4-yl]-4-methylphenyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cccs2)cc1-c1nc(NC2CC(C)(C)NC(C)(C)C2)nc2c1ccc(=O)n2-c1c(F)cccc1F |
| InChI | InChI=1S/C34H34F2N6O2S/c1-19-11-12-20(37-31(44)26-10-7-15-45-26)16-23(19)28-22-13-14-27(43)42(29-24(35)8-6-9-25(29)36)30(22)40-32(39-28)38-21-17-33(2,3)41-34(4,5)18-21/h6-16,21,41H,17-18H2,1-5H3,(H,37,44)(H,38,39,40) |
| InChIKey | ALSRBDSZLBHGPS-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.75 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |