C15H19ClN4O2 — CID 119482974
(3-aminopyrrolidin-1-yl)-[1-(4-methoxyphenyl)pyrazol-3-yl]methanone;hydrochloride (PubChem CID 119482974) has the molecular formula C15H19ClN4O2 and a molecular weight of 322.80 g/mol. Its IUPAC name is (3-aminopyrrolidin-1-yl)-[1-(4-methoxyphenyl)pyrazol-3-yl]methanone;hydrochloride.
| Compound Name | (3-aminopyrrolidin-1-yl)-[1-(4-methoxyphenyl)pyrazol-3-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119482974 |
| Molecular Formula | C15H19ClN4O2 |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (3-aminopyrrolidin-1-yl)-[1-(4-methoxyphenyl)pyrazol-3-yl]methanone;hydrochloride |
| SMILES | COc1ccc(-n2ccc(C(=O)N3CCC(N)C3)n2)cc1.Cl |
| InChI | InChI=1S/C15H18N4O2.ClH/c1-21-13-4-2-12(3-5-13)19-9-7-14(17-19)15(20)18-8-6-11(16)10-18;/h2-5,7,9,11H,6,8,10,16H2,1H3;1H |
| InChIKey | XGNAYRHYZFINAL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |